| Name | Borane-triphenylphosphine complex |
| Synonyms | Borane triphenylphosph TriphenylphosphinBorane TRIPHENYLPHOSPHINE BORANE BORANE-TRIPHENYLPHOSPHINE BORANE-TRIPHENYLPHOSPHINE COMPLEX Borane-triphenylphosphine complex Boran-Triphenylphosphine Complex |
| CAS | 2049-55-0 |
| InChI | InChI=1/C18H15P.BH3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H3 |
| Molecular Formula | C18H18BP |
| Molar Mass | 276.12 |
| Melting Point | 189-191 °C (lit.) |
| Boling Point | 360°C at 760 mmHg |
| Flash Point | 181.7°C |
| Vapor Presure | 4.74E-05mmHg at 25°C |
| Appearance | White crystals have an unpleasant smell. |
| Color | White |
| Storage Condition | Refrigerator |
| Stability | Stable. Incompatible with acids, oxidizing agents, acid chlorides, alcohols. May decompose on exposure to air and moisture. |
| Sensitive | Air & Moisture Sensitive |
| MDL | MFCD00012427 |
| UN IDs | UN3396 |
| WGK Germany | 3 |
| HS Code | 29319019 |
| Hazard Class | 4.3 |
| Packing Group | II |